| Product Name | methyl 5-Bromo-6-chloro-1H-indole-3-carboxylate |
|---|---|
| CAS | 1467059-91-1 |
| Formula | C10H7BrClNO2 |
| MW | 288.53 |
Product Center
MF:
C10H7BrClNO2
MW:
288.53
Characters:
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB21199 | yunbang | 250mg | 95+% | $173.33 | Visible after login | Inquiry | ||
| YB21199 | yunbang | 1g | 95+% | $438.33 | Visible after login | Inquiry |
| Product Name | methyl 5-Bromo-6-chloro-1H-indole-3-carboxylate |
|---|---|
| CAS | 1467059-91-1 |
| Formula | C10H7BrClNO2 |
| MW | 288.53 |
| CAS | 1467059-91-1 |
|---|---|
| Formula | C10H7BrClNO2 |
| MW | 288.53 |
| Smiles | COC(c1c2cc(c(Cl)cc2[nH]c1)Br)=O |
| InchiKey | PLMOQYXKIYBPBH-UHFFFAOYSA-N |