| Product Name | Trans-4-{5-bromo-2-chloro-7H-pyrrolo[2,3-d]pyrimidin-7-yl}cyclohexan-1-ol |
|---|---|
| CAS | 1630906-40-9 |
| Formula | C12H13BrClN3O |
| MW | 330.612 |
| MDL | MFCD27987955 |
Product Center
MF:
C12H13BrClN3O
MW:
330.612
Characters:
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB27080 | yunbang | 100mg | 98+% | $10.00 | Visible after login | Inquiry | ||
| YB27080 | yunbang | 250mg | 98+% | $18.33 | Visible after login | Inquiry | ||
| YB27080 | yunbang | 1g | 98+% | $55.00 | Visible after login | Inquiry | ||
| YB27080 | yunbang | 5g | 98+% | $200.00 | Visible after login | Inquiry |
| Product Name | Trans-4-{5-bromo-2-chloro-7H-pyrrolo[2,3-d]pyrimidin-7-yl}cyclohexan-1-ol |
|---|---|
| CAS | 1630906-40-9 |
| Formula | C12H13BrClN3O |
| MW | 330.612 |
| MDL | MFCD27987955 |
| CAS | 1630906-40-9 |
|---|---|
| Formula | C12H13BrClN3O |
| MW | 330.612 |
| MDL | MFCD27987955 |
| Smiles | O[C@@H]1CC[C@@H](N2C3C(=CN=C(N=3)Cl)C(Br)=C2)CC1 |
| InchiKey | VLPKMHQJURMLAN-ZKCHVHJHSA-N |