| Product Name | 3-methyl-5-propan-2-yl-2-(1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)naphthalene-1,6,7-triol |
|---|---|
| CAS | 475-56-9 |
| Formula | C28H30O6 |
| MW | 462.534 |
Product Center
MF:
C28H30O6
MW:
462.534
Characters:
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB27829 | yunbang | 1g | 98+% | $625.00 | Visible after login | Inquiry |
| Product Name | 3-methyl-5-propan-2-yl-2-(1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)naphthalene-1,6,7-triol |
|---|---|
| CAS | 475-56-9 |
| Formula | C28H30O6 |
| MW | 462.534 |
| CAS | 475-56-9 |
|---|---|
| Formula | C28H30O6 |
| MW | 462.534 |
| Smiles | OC1C(C2C(O)=C3C(C(=C(C(=C3)O)O)C(C)C)=CC=2C)=C(C)C=C2C=1C=C(C(=C2C(C)C)O)O |
| InchiKey | PBJKWGWHZVXBGU-UHFFFAOYSA-N |