| Product Name | DBCO-PEG4-NH2 |
|---|---|
| CAS | 1255942-08-5 |
| Formula | C29H37N3O6 |
| MW | 523.626 |
Product Center
MF:
C29H37N3O6
MW:
523.626
Characters:
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB52468 | yunbang | 1g | 95% | $2316.67 | Visible after login | Inquiry |
| Product Name | DBCO-PEG4-NH2 |
|---|---|
| CAS | 1255942-08-5 |
| Formula | C29H37N3O6 |
| MW | 523.626 |
| CAS | 1255942-08-5 |
|---|---|
| Formula | C29H37N3O6 |
| MW | 523.626 |
| Smiles | NCCOCCOCCOCCOCCC(NCCC(N1c2ccccc2C#Cc2c(cccc2)C1)=O)=O |
| InchiKey | KTIOBJVNCOFWCL-UHFFFAOYSA-N |