| Product Name | Solifenacin succinate |
|---|---|
| Chinese alias | Solifenacin succinate |
| CAS | 242478-38-2 |
| Formula | C23H26N2O2.C4H6O4 |
| MW | 480.55 |
| MDL | MFCD00954234 |
| Melting point | 505.5oC at 760 mmHg |
| Boiling point | 505.5 |
| Storage condition | 2-8°C |
Product Center
MF:
C23H26N2O2.C4H6O4
MW:
480.55
Characters:
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB53868 | yunbang | 250mg | 98% | $38.33 | Visible after login | Inquiry | ||
| YB53868 | yunbang | 1g | 98% | $98.33 | Visible after login | Inquiry | ||
| YB53868 | yunbang | 5g | 98% | $353.33 | Visible after login | Inquiry |
| Product Name | Solifenacin succinate |
|---|---|
| Chinese alias | Solifenacin succinate |
| CAS | 242478-38-2 |
| Formula | C23H26N2O2.C4H6O4 |
| MW | 480.55 |
| MDL | MFCD00954234 |
| Melting point | 505.5oC at 760 mmHg |
| Boiling point | 505.5 |
| Storage condition | 2-8°C |
| Chinese alias | Solifenacin succinate |
|---|---|
| CAS | 242478-38-2 |
| Formula | C23H26N2O2.C4H6O4 |
| MW | 480.55 |
| MDL | MFCD00954234 |
| Melting point | 505.5oC at 760 mmHg |
| Boiling point | 505.5 |
| Storage | 2-8°C |
| Smiles | C(C(=O)O)CC(=O)O.C(N1CCC2=CC=CC=C2[C@@H]1C1C=CC=CC=1)(=O)O[C@H]1CN2CCC1CC2 |
| InchiKey | RXZMMZZRUPYENV-VROPFNGYSA-N |